C31H29ClN6OS2 — CID 172548995
N-[3-[5-(5-aminopent-1-ynyl)thiophen-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide (PubChem CID 172548995) has the molecular formula C31H29ClN6OS2 and a molecular weight of 601.20 g/mol. Its IUPAC name is N-[3-[5-(5-aminopent-1-ynyl)thiophen-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide.
| Compound Name | N-[3-[5-(5-aminopent-1-ynyl)thiophen-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide |
|---|---|
| PubChem CID | 172548995 |
| Molecular Formula | C31H29ClN6OS2 |
| Molecular Weight | 601.20 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | N-[3-[5-(5-aminopent-1-ynyl)thiophen-2-yl]prop-2-ynyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCC#Cc1ccc(C#CCCCN)s1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C31H29ClN6OS2/c1-19-20(2)40-31-28(19)29(22-10-12-23(32)13-11-22)35-26(30-37-36-21(3)38(30)31)18-27(39)34-17-7-9-25-15-14-24(41-25)8-5-4-6-16-33/h10-15,26H,4,6,16-18,33H2,1-3H3,(H,34,39)/t26-/m0/s1 |
| InChIKey | OWFBIODEBVCPMN-SANMLTNESA-N |
| XLogP | 5.51 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.20 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|