C27H22ClN7O2S — CID 135290602
N'-acetyl-2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetohydrazide (PubChem CID 135290602) has the molecular formula C27H22ClN7O2S and a molecular weight of 544.04 g/mol. Its IUPAC name is N'-acetyl-2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetohydrazide.
| Compound Name | N'-acetyl-2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetohydrazide |
|---|---|
| PubChem CID | 135290602 |
| Molecular Formula | C27H22ClN7O2S |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N'-acetyl-2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c2c(sc(C#Cc3ccccn3)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C27H22ClN7O2S/c1-15-22(12-11-20-6-4-5-13-29-20)38-27-24(15)25(18-7-9-19(28)10-8-18)30-21(14-23(37)33-32-17(3)36)26-34-31-16(2)35(26)27/h4-10,13,21H,14H2,1-3H3,(H,32,36)(H,33,37)/t21-/m0/s1 |
| InChIKey | XFVCHRDCBBZJSR-NRFANRHFSA-N |
| XLogP | 3.84 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|