C31H30ClN7OS — CID 135290645
2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 135290645) has the molecular formula C31H30ClN7OS and a molecular weight of 584.15 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 135290645 |
| Molecular Formula | C31H30ClN7OS |
| Molecular Weight | 584.15 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1c(C#Cc2ccccn2)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NC1CCN(C)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C31H30ClN7OS/c1-19-26(12-11-23-6-4-5-15-33-23)41-31-28(19)29(21-7-9-22(32)10-8-21)35-25(30-37-36-20(2)39(30)31)18-27(40)34-24-13-16-38(3)17-14-24/h4-10,15,24-25H,13-14,16-18H2,1-3H3,(H,34,40)/t25-/m0/s1 |
| InChIKey | HKUMBTIUIKBVJE-VWLOTQADSA-N |
| XLogP | 4.89 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.15 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|