C25H19ClN6OS — CID 135290625
2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide (PubChem CID 135290625) has the molecular formula C25H19ClN6OS and a molecular weight of 486.99 g/mol. Its IUPAC name is 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide.
| Compound Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide |
|---|---|
| PubChem CID | 135290625 |
| Molecular Formula | C25H19ClN6OS |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[(9S)-7-(4-chlorophenyl)-5,13-dimethyl-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide |
| SMILES | Cc1c(C#Cc2ccccn2)sc2c1C(c1ccc(Cl)cc1)=N[C@@H](CC(N)=O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C25H19ClN6OS/c1-14-20(11-10-18-5-3-4-12-28-18)34-25-22(14)23(16-6-8-17(26)9-7-16)29-19(13-21(27)33)24-31-30-15(2)32(24)25/h3-9,12,19H,13H2,1-2H3,(H2,27,33)/t19-/m0/s1 |
| InChIKey | MVYHUTHGSUOKEW-IBGZPJMESA-N |
| XLogP | 4.16 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|