C11H20F5NOS — CID 134360039
(S)-2-methyl-N-(1,1,1,2,2-pentafluoro-4,4-dimethylpentan-3-yl)propane-2-sulfinamide (PubChem CID 134360039) has the molecular formula C11H20F5NOS and a molecular weight of 309.34 g/mol. Its IUPAC name is (S)-2-methyl-N-(1,1,1,2,2-pentafluoro-4,4-dimethylpentan-3-yl)propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-(1,1,1,2,2-pentafluoro-4,4-dimethylpentan-3-yl)propane-2-sulfinamide |
|---|---|
| PubChem CID | 134360039 |
| Molecular Formula | C11H20F5NOS |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (S)-2-methyl-N-(1,1,1,2,2-pentafluoro-4,4-dimethylpentan-3-yl)propane-2-sulfinamide |
| SMILES | CC(C)(C)C(N[S@@](=O)C(C)(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5NOS/c1-8(2,3)7(10(12,13)11(14,15)16)17-19(18)9(4,5)6/h7,17H,1-6H3/t7?,19-/m0/s1 |
| InChIKey | JCKBDBGGZLZGTO-BTJLCUAISA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|