C10H20F3NOS — CID 134969143
tert-butyl-oxido-[[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]amino]sulfanium (PubChem CID 134969143) has the molecular formula C10H20F3NOS and a molecular weight of 259.34 g/mol. Its IUPAC name is tert-butyl-oxido-[[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]amino]sulfanium.
| Compound Name | tert-butyl-oxido-[[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]amino]sulfanium |
|---|---|
| PubChem CID | 134969143 |
| Molecular Formula | C10H20F3NOS |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | tert-butyl-oxido-[[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]amino]sulfanium |
| SMILES | CC(C)(C)[C@@H](N[S+]([O-])C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NOS/c1-8(2,3)7(10(11,12)13)14-16(15)9(4,5)6/h7,14H,1-6H3/t7-,16?/m1/s1 |
| InChIKey | HTPPSTBGTZPJSU-MSSWUJIJSA-N |
| XLogP | 3.02 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|