C11H11N3O2 — CID 134360357
6-(ethylideneamino)-7-methyl-1H-quinazoline-2,4-dione (PubChem CID 134360357) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-(ethylideneamino)-7-methyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-(ethylideneamino)-7-methyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 134360357 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6-(ethylideneamino)-7-methyl-1H-quinazoline-2,4-dione |
| SMILES | C/C=N/c1cc2c(=O)[nH]c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C11H11N3O2/c1-3-12-8-5-7-9(4-6(8)2)13-11(16)14-10(7)15/h3-5H,1-2H3,(H2,13,14,15,16)/b12-3+ |
| InChIKey | VPNOTXVUVFUNPG-KGVSQERTSA-N |
| XLogP | 1.25 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|