C16H15NO3 — CID 134360577
[2-[(4-hydroxy-2,5-dimethylphenoxy)methyl]phenyl] cyanate (PubChem CID 134360577) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is [2-[(4-hydroxy-2,5-dimethylphenoxy)methyl]phenyl] cyanate.
| Compound Name | [2-[(4-hydroxy-2,5-dimethylphenoxy)methyl]phenyl] cyanate |
|---|---|
| PubChem CID | 134360577 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [2-[(4-hydroxy-2,5-dimethylphenoxy)methyl]phenyl] cyanate |
| SMILES | Cc1cc(OCc2ccccc2OC#N)c(C)cc1O |
| InChI | InChI=1S/C16H15NO3/c1-11-8-16(12(2)7-14(11)18)19-9-13-5-3-4-6-15(13)20-10-17/h3-8,18H,9H2,1-2H3 |
| InChIKey | LJHZLEXRHSAQFS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|