C22H15N3O2 — CID 134361331
methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzoate (PubChem CID 134361331) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzoate.
| Compound Name | methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzoate |
|---|---|
| PubChem CID | 134361331 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1cc2[nH]c3ccncc3c2c2ncccc12 |
| InChI | InChI=1S/C22H15N3O2/c1-27-22(26)15-6-3-2-5-13(15)16-11-19-20(21-14(16)7-4-9-24-21)17-12-23-10-8-18(17)25-19/h2-12,25H,1H3 |
| InChIKey | VJUWVANEMIKQNG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |