C23H16N2O2 — CID 134361330
methyl 2-(11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-8-yl)benzoate (PubChem CID 134361330) has the molecular formula C23H16N2O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 2-(11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-8-yl)benzoate.
| Compound Name | methyl 2-(11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-8-yl)benzoate |
|---|---|
| PubChem CID | 134361330 |
| Molecular Formula | C23H16N2O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 2-(11,13-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-8-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1cc2[nH]c3ncccc3c2c2ccccc12 |
| InChI | InChI=1S/C23H16N2O2/c1-27-23(26)17-10-5-3-8-15(17)19-13-20-21(16-9-4-2-7-14(16)19)18-11-6-12-24-22(18)25-20/h2-13H,1H3,(H,24,25) |
| InChIKey | NPXQENYIWAXDRZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |