C25H24N4O3 — CID 134361744
methyl 2-cyclopropyl-6-morpholin-4-yl-1-quinolin-4-ylbenzimidazole-4-carboxylate (PubChem CID 134361744) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl 2-cyclopropyl-6-morpholin-4-yl-1-quinolin-4-ylbenzimidazole-4-carboxylate.
| Compound Name | methyl 2-cyclopropyl-6-morpholin-4-yl-1-quinolin-4-ylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 134361744 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | methyl 2-cyclopropyl-6-morpholin-4-yl-1-quinolin-4-ylbenzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cc(N2CCOCC2)cc2c1nc(C1CC1)n2-c1ccnc2ccccc12 |
| InChI | InChI=1S/C25H24N4O3/c1-31-25(30)19-14-17(28-10-12-32-13-11-28)15-22-23(19)27-24(16-6-7-16)29(22)21-8-9-26-20-5-3-2-4-18(20)21/h2-5,8-9,14-16H,6-7,10-13H2,1H3 |
| InChIKey | YNIOXKZRTZTZNB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |