C44H36N6O3 — CID 134361752
methyl 6-morpholin-4-yl-1-[2-(1-tritylpyrazol-4-yl)quinolin-4-yl]benzimidazole-4-carboxylate (PubChem CID 134361752) has the molecular formula C44H36N6O3 and a molecular weight of 696.81 g/mol. Its IUPAC name is methyl 6-morpholin-4-yl-1-[2-(1-tritylpyrazol-4-yl)quinolin-4-yl]benzimidazole-4-carboxylate.
| Compound Name | methyl 6-morpholin-4-yl-1-[2-(1-tritylpyrazol-4-yl)quinolin-4-yl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 134361752 |
| Molecular Formula | C44H36N6O3 |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | methyl 6-morpholin-4-yl-1-[2-(1-tritylpyrazol-4-yl)quinolin-4-yl]benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cc(N2CCOCC2)cc2c1ncn2-c1cc(-c2cnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)nc2ccccc12 |
| InChI | InChI=1S/C44H36N6O3/c1-52-43(51)37-25-35(48-21-23-53-24-22-48)26-41-42(37)45-30-49(41)40-27-39(47-38-20-12-11-19-36(38)40)31-28-46-50(29-31)44(32-13-5-2-6-14-32,33-15-7-3-8-16-33)34-17-9-4-10-18-34/h2-20,25-30H,21-24H2,1H3 |
| InChIKey | OSXNEJMXKVIPCM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|