C43H36N4O3 — CID 177077621
[2-methoxy-4-[3-(1-tritylpyrazol-4-yl)phenyl]quinolin-6-yl]-morpholin-4-ylmethanone (PubChem CID 177077621) has the molecular formula C43H36N4O3 and a molecular weight of 656.79 g/mol. Its IUPAC name is [2-methoxy-4-[3-(1-tritylpyrazol-4-yl)phenyl]quinolin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-methoxy-4-[3-(1-tritylpyrazol-4-yl)phenyl]quinolin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 177077621 |
| Molecular Formula | C43H36N4O3 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | [2-methoxy-4-[3-(1-tritylpyrazol-4-yl)phenyl]quinolin-6-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cc(-c2cccc(-c3cnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)c2)c2cc(C(=O)N3CCOCC3)ccc2n1 |
| InChI | InChI=1S/C43H36N4O3/c1-49-41-28-38(39-27-33(20-21-40(39)45-41)42(48)46-22-24-50-25-23-46)32-13-11-12-31(26-32)34-29-44-47(30-34)43(35-14-5-2-6-15-35,36-16-7-3-8-17-36)37-18-9-4-10-19-37/h2-21,26-30H,22-25H2,1H3 |
| InChIKey | NOYYJWPWBNEINJ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|