C27H28FN7O6S2 — CID 134363241
2-[4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-6-[(3R)-3-methylmorpholin-4-yl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 134363241) has the molecular formula C27H28FN7O6S2 and a molecular weight of 629.70 g/mol. Its IUPAC name is 2-[4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-6-[(3R)-3-methylmorpholin-4-yl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 2-[4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-6-[(3R)-3-methylmorpholin-4-yl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 134363241 |
| Molecular Formula | C27H28FN7O6S2 |
| Molecular Weight | 629.70 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | 2-[4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-6-[(3R)-3-methylmorpholin-4-yl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | COc1c(Nc2cc(C)[nH]n2)nc(Sc2ccc(S(=O)(=O)Cc3cccc([N+](=O)[O-])c3F)cc2)nc1N1CCOC[C@H]1C |
| InChI | InChI=1S/C27H28FN7O6S2/c1-16-13-22(33-32-16)29-25-24(40-3)26(34-11-12-41-14-17(34)2)31-27(30-25)42-19-7-9-20(10-8-19)43(38,39)15-18-5-4-6-21(23(18)28)35(36)37/h4-10,13,17H,11-12,14-15H2,1-3H3,(H2,29,30,31,32,33)/t17-/m1/s1 |
| InChIKey | KXLDMBDTWWLYQX-QGZVFWFLSA-N |
| XLogP | 4.66 |
| TPSA | 165.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|