C22H17ClF2N6O5S2 — CID 134370140
6-chloro-2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 134370140) has the molecular formula C22H17ClF2N6O5S2 and a molecular weight of 583.00 g/mol. Its IUPAC name is 6-chloro-2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 134370140 |
| Molecular Formula | C22H17ClF2N6O5S2 |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | 6-chloro-2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | COc1c(Cl)nc(Sc2ccc(S(=O)(=O)Cc3cccc([N+](=O)[O-])c3F)cc2F)nc1Nc1cc(C)[nH]n1 |
| InChI | InChI=1S/C22H17ClF2N6O5S2/c1-11-8-17(30-29-11)26-21-19(36-2)20(23)27-22(28-21)37-16-7-6-13(9-14(16)24)38(34,35)10-12-4-3-5-15(18(12)25)31(32)33/h3-9H,10H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | DHWHKSSRUGRNCY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|