C27H31F2N7O5S2 — CID 172652529
2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methylpyrazolidin-3-yl)-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 172652529) has the molecular formula C27H31F2N7O5S2 and a molecular weight of 635.72 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methylpyrazolidin-3-yl)-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | 2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methylpyrazolidin-3-yl)-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172652529 |
| Molecular Formula | C27H31F2N7O5S2 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | 2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methylpyrazolidin-3-yl)-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | COc1c(NC2CC(C)NN2)nc(Sc2ccc(S(=O)(=O)Cc3cccc([N+](=O)[O-])c3F)cc2F)nc1N1CCCCC1 |
| InChI | InChI=1S/C27H31F2N7O5S2/c1-16-13-22(34-33-16)30-25-24(41-2)26(35-11-4-3-5-12-35)32-27(31-25)42-21-10-9-18(14-19(21)28)43(39,40)15-17-7-6-8-20(23(17)29)36(37)38/h6-10,14,16,22,33-34H,3-5,11-13,15H2,1-2H3,(H,30,31,32) |
| InChIKey | XEXCIFZBAVYOGA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|