C13H24N2O2 — CID 13436733
3-butyl-4-hydroxy-1,3-diazaspiro[4.6]undecan-2-one (PubChem CID 13436733) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-butyl-4-hydroxy-1,3-diazaspiro[4.6]undecan-2-one.
| Compound Name | 3-butyl-4-hydroxy-1,3-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 13436733 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 3-butyl-4-hydroxy-1,3-diazaspiro[4.6]undecan-2-one |
| SMILES | CCCCN1C(=O)NC2(CCCCCC2)C1O |
| InChI | InChI=1S/C13H24N2O2/c1-2-3-10-15-11(16)13(14-12(15)17)8-6-4-5-7-9-13/h11,16H,2-10H2,1H3,(H,14,17) |
| InChIKey | DBGUKBZIVPABGB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |