C46H41F3O2 — CID 134371384
2-butoxy-6-[2-[2-fluoro-4-[3-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-6-methoxyphenyl]ethynyl]naphthalene (PubChem CID 134371384) has the molecular formula C46H41F3O2 and a molecular weight of 682.83 g/mol. Its IUPAC name is 2-butoxy-6-[2-[2-fluoro-4-[3-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-6-methoxyphenyl]ethynyl]naphthalene.
| Compound Name | 2-butoxy-6-[2-[2-fluoro-4-[3-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-6-methoxyphenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 134371384 |
| Molecular Formula | C46H41F3O2 |
| Molecular Weight | 682.83 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 2-butoxy-6-[2-[2-fluoro-4-[3-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-6-methoxyphenyl]ethynyl]naphthalene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4cc(F)c(C#Cc5ccc6cc(OCCCC)ccc6c5)c(OC)c4)cc3F)c(F)c2)cc1 |
| InChI | InChI=1S/C46H41F3O2/c1-4-6-8-9-31-10-14-33(15-11-31)36-18-22-40(43(47)27-36)41-23-19-37(28-44(41)48)38-29-45(49)42(46(30-38)50-3)21-13-32-12-16-35-26-39(51-24-7-5-2)20-17-34(35)25-32/h10-12,14-20,22-23,25-30H,4-9,24H2,1-3H3 |
| InChIKey | XFGJGMHJGAWUBZ-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.83 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|