C13H19N3O2 — CID 134372059
methyl 6-(3,3-dimethylpiperazin-1-yl)pyridine-2-carboxylate (PubChem CID 134372059) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl 6-(3,3-dimethylpiperazin-1-yl)pyridine-2-carboxylate.
| Compound Name | methyl 6-(3,3-dimethylpiperazin-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134372059 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | methyl 6-(3,3-dimethylpiperazin-1-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(N2CCNC(C)(C)C2)n1 |
| InChI | InChI=1S/C13H19N3O2/c1-13(2)9-16(8-7-14-13)11-6-4-5-10(15-11)12(17)18-3/h4-6,14H,7-9H2,1-3H3 |
| InChIKey | UEAPIZONOVZRGY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |