C13H23NS — CID 134372333
7-methyl-7-propan-2-yl-4,5,6,8,9,9a-hexahydro-3aH-cycloocta[d][1,3]thiazole (PubChem CID 134372333) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 7-methyl-7-propan-2-yl-4,5,6,8,9,9a-hexahydro-3aH-cycloocta[d][1,3]thiazole.
| Compound Name | 7-methyl-7-propan-2-yl-4,5,6,8,9,9a-hexahydro-3aH-cycloocta[d][1,3]thiazole |
|---|---|
| PubChem CID | 134372333 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 7-methyl-7-propan-2-yl-4,5,6,8,9,9a-hexahydro-3aH-cycloocta[d][1,3]thiazole |
| SMILES | CC(C)C1(C)CCCC2N=CSC2CC1 |
| InChI | InChI=1S/C13H23NS/c1-10(2)13(3)7-4-5-11-12(6-8-13)15-9-14-11/h9-12H,4-8H2,1-3H3 |
| InChIKey | IIJALVJFTQUQPS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |