C25H31F2N3O5 — CID 134377121
N-[(2,4-difluorophenyl)methyl]-8,9-dihydroxy-1-oxo-2-propan-2-yl-3'-propan-2-yloxyspiro[3,8-dihydropyrido[1,2-a]pyrazine-4,1'-cyclobutane]-7-carboxamide (PubChem CID 134377121) has the molecular formula C25H31F2N3O5 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-8,9-dihydroxy-1-oxo-2-propan-2-yl-3'-propan-2-yloxyspiro[3,8-dihydropyrido[1,2-a]pyrazine-4,1'-cyclobutane]-7-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-8,9-dihydroxy-1-oxo-2-propan-2-yl-3'-propan-2-yloxyspiro[3,8-dihydropyrido[1,2-a]pyrazine-4,1'-cyclobutane]-7-carboxamide |
|---|---|
| PubChem CID | 134377121 |
| Molecular Formula | C25H31F2N3O5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-8,9-dihydroxy-1-oxo-2-propan-2-yl-3'-propan-2-yloxyspiro[3,8-dihydropyrido[1,2-a]pyrazine-4,1'-cyclobutane]-7-carboxamide |
| SMILES | CC(C)OC1CC2(C1)CN(C(C)C)C(=O)C1=C(O)C(O)C(C(=O)NCc3ccc(F)cc3F)=CN12 |
| InChI | InChI=1S/C25H31F2N3O5/c1-13(2)29-12-25(8-17(9-25)35-14(3)4)30-11-18(21(31)22(32)20(30)24(29)34)23(33)28-10-15-5-6-16(26)7-19(15)27/h5-7,11,13-14,17,21,31-32H,8-10,12H2,1-4H3,(H,28,33) |
| InChIKey | IFGFFQBJPPBFKV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |