C21H24F2N4O4 — CID 146205798
(2R)-N-[(2,4-difluorophenyl)methyl]-2-(ethylamino)-9,10-dihydroxy-6-methyl-7-oxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide (PubChem CID 146205798) has the molecular formula C21H24F2N4O4 and a molecular weight of 434.44 g/mol. Its IUPAC name is (2R)-N-[(2,4-difluorophenyl)methyl]-2-(ethylamino)-9,10-dihydroxy-6-methyl-7-oxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide.
| Compound Name | (2R)-N-[(2,4-difluorophenyl)methyl]-2-(ethylamino)-9,10-dihydroxy-6-methyl-7-oxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
|---|---|
| PubChem CID | 146205798 |
| Molecular Formula | C21H24F2N4O4 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (2R)-N-[(2,4-difluorophenyl)methyl]-2-(ethylamino)-9,10-dihydroxy-6-methyl-7-oxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
| SMILES | CCN[C@@H]1CC2CN(C)C(=O)C3=C(O)C(O)C(C(=O)NCc4ccc(F)cc4F)=C1N32 |
| InChI | InChI=1S/C21H24F2N4O4/c1-3-24-14-7-12-9-26(2)21(31)17-19(29)18(28)15(16(14)27(12)17)20(30)25-8-10-4-5-11(22)6-13(10)23/h4-6,12,14,18,24,28-29H,3,7-9H2,1-2H3,(H,25,30)/t12?,14-,18?/m1/s1 |
| InChIKey | RJJKCYFWKOKTTB-HZEYSBKDSA-N |
| XLogP | 0.50 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |