C17H22F3N5O3 — CID 134381920
5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-(2,2,2-trifluoroethyl)imidazole-4-carboxamide (PubChem CID 134381920) has the molecular formula C17H22F3N5O3 and a molecular weight of 401.39 g/mol. Its IUPAC name is 5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-(2,2,2-trifluoroethyl)imidazole-4-carboxamide.
| Compound Name | 5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-(2,2,2-trifluoroethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 134381920 |
| Molecular Formula | C17H22F3N5O3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-(2,2,2-trifluoroethyl)imidazole-4-carboxamide |
| SMILES | Cc1cc(CCCCN(C)C(=O)c2c(N(C)C=O)ncn2CC(F)(F)F)on1 |
| InChI | InChI=1S/C17H22F3N5O3/c1-12-8-13(28-22-12)6-4-5-7-23(2)16(27)14-15(24(3)11-26)21-10-25(14)9-17(18,19)20/h8,10-11H,4-7,9H2,1-3H3 |
| InChIKey | HWQRJUGDUGIVNU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|