C18H27N5O3 — CID 134381736
5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-propylimidazole-4-carboxamide (PubChem CID 134381736) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-propylimidazole-4-carboxamide.
| Compound Name | 5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-propylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 134381736 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 5-[formyl(methyl)amino]-N-methyl-N-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-3-propylimidazole-4-carboxamide |
| SMILES | CCCn1cnc(N(C)C=O)c1C(=O)N(C)CCCCc1cc(C)no1 |
| InChI | InChI=1S/C18H27N5O3/c1-5-9-23-12-19-17(22(4)13-24)16(23)18(25)21(3)10-7-6-8-15-11-14(2)20-26-15/h11-13H,5-10H2,1-4H3 |
| InChIKey | COTACBKHSYJQTE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|