C20H29N5O3 — CID 134381879
3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-7-(2-methylpentyl)purine-2,6-dione (PubChem CID 134381879) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-7-(2-methylpentyl)purine-2,6-dione.
| Compound Name | 3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-7-(2-methylpentyl)purine-2,6-dione |
|---|---|
| PubChem CID | 134381879 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-7-(2-methylpentyl)purine-2,6-dione |
| SMILES | CCCC(C)Cn1cnc2c1c(=O)n(CCCCc1cc(C)no1)c(=O)n2C |
| InChI | InChI=1S/C20H29N5O3/c1-5-8-14(2)12-24-13-21-18-17(24)19(26)25(20(27)23(18)4)10-7-6-9-16-11-15(3)22-28-16/h11,13-14H,5-10,12H2,1-4H3 |
| InChIKey | ZRAPEYBKDGQRPN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|