C24H37N5O3 — CID 145188695
butane;7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]purine-2,6-dione (PubChem CID 145188695) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is butane;7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]purine-2,6-dione.
| Compound Name | butane;7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]purine-2,6-dione |
|---|---|
| PubChem CID | 145188695 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | butane;7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]purine-2,6-dione |
| SMILES | CCCC.Cc1cc(CCCCn2c(=O)c3c(ncn3CC3CCCC3)n(C)c2=O)on1 |
| InChI | InChI=1S/C20H27N5O3.C4H10/c1-14-11-16(28-22-14)9-5-6-10-25-19(26)17-18(23(2)20(25)27)21-13-24(17)12-15-7-3-4-8-15;1-3-4-2/h11,13,15H,3-10,12H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | FDTKUMCEBWFICM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 87.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|