C20H29N5O2 — CID 134381895
7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-2H-purin-6-one (PubChem CID 134381895) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-2H-purin-6-one.
| Compound Name | 7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-2H-purin-6-one |
|---|---|
| PubChem CID | 134381895 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 7-(cyclopentylmethyl)-3-methyl-1-[4-(3-methyl-1,2-oxazol-5-yl)butyl]-2H-purin-6-one |
| SMILES | Cc1cc(CCCCN2CN(C)c3ncn(CC4CCCC4)c3C2=O)on1 |
| InChI | InChI=1S/C20H29N5O2/c1-15-11-17(27-22-15)9-5-6-10-24-14-23(2)19-18(20(24)26)25(13-21-19)12-16-7-3-4-8-16/h11,13,16H,3-10,12,14H2,1-2H3 |
| InChIKey | LEVIMTNIUWODLK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|