C11H14F3N — CID 134383256
(3E,5E)-5-(1,2-difluoroethylidene)-4-fluoro-N-methylocta-1,3,7-trien-3-amine (PubChem CID 134383256) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is (3E,5E)-5-(1,2-difluoroethylidene)-4-fluoro-N-methylocta-1,3,7-trien-3-amine.
| Compound Name | (3E,5E)-5-(1,2-difluoroethylidene)-4-fluoro-N-methylocta-1,3,7-trien-3-amine |
|---|---|
| PubChem CID | 134383256 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (3E,5E)-5-(1,2-difluoroethylidene)-4-fluoro-N-methylocta-1,3,7-trien-3-amine |
| SMILES | C=CCC(=C(\F)CF)/C(F)=C(/C=C)NC |
| InChI | InChI=1S/C11H14F3N/c1-4-6-8(9(13)7-12)11(14)10(5-2)15-3/h4-5,15H,1-2,6-7H2,3H3/b9-8+,11-10+ |
| InChIKey | YCAJZAAXYMXVRL-BNFZFUHLSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|