C13H14F11N — CID 134384146
1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 134384146) has the molecular formula C13H14F11N and a molecular weight of 393.24 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 134384146 |
| Molecular Formula | C13H14F11N |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoro-4-methylpent-4-enyl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | C=C(C)C(F)(F)C(F)C(F)(F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14F11N/c1-6(2)10(15,16)9(14)13(23,24)25-4-7(11(17,18)19)3-8(5-25)12(20,21)22/h7-9H,1,3-5H2,2H3 |
| InChIKey | XQXXDBPSRNIHQY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|