C11H11NO — CID 134386992
(5Z,7Z)-2-oxabicyclo[6.3.1]dodeca-1(11),5,7,9-tetraen-12-imine (PubChem CID 134386992) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is (5Z,7Z)-2-oxabicyclo[6.3.1]dodeca-1(11),5,7,9-tetraen-12-imine.
| Compound Name | (5Z,7Z)-2-oxabicyclo[6.3.1]dodeca-1(11),5,7,9-tetraen-12-imine |
|---|---|
| PubChem CID | 134386992 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (5Z,7Z)-2-oxabicyclo[6.3.1]dodeca-1(11),5,7,9-tetraen-12-imine |
| SMILES | [H]/N=C1\C2=CC=C\C1=C\C=C/CCO2 |
| InChI | InChI=1S/C11H11NO/c12-11-9-5-2-1-3-8-13-10(11)7-4-6-9/h1-2,4-7,12H,3,8H2/b2-1-,9-5-,12-11- |
| InChIKey | FGPFBWAGIIVQIW-AIPJNDDFSA-N |
| XLogP | 2.36 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|