C8H11NO — CID 173301169
2-methoxy-3-methylcyclohexa-2,4-dien-1-imine (PubChem CID 173301169) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-methoxy-3-methylcyclohexa-2,4-dien-1-imine.
| Compound Name | 2-methoxy-3-methylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 173301169 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-methoxy-3-methylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\CC=CC(C)=C1OC |
| InChI | InChI=1S/C8H11NO/c1-6-4-3-5-7(9)8(6)10-2/h3-4,9H,5H2,1-2H3/b9-7+ |
| InChIKey | UKPKUSVAYNMWAC-VQHVLOKHSA-N |
| XLogP | 1.89 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|