C42H45NO — CID 134390460
6-(3,4,5a,9a-tetrahydrodibenzofuran-4-yl)-9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole (PubChem CID 134390460) has the molecular formula C42H45NO and a molecular weight of 579.83 g/mol. Its IUPAC name is 6-(3,4,5a,9a-tetrahydrodibenzofuran-4-yl)-9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole.
| Compound Name | 6-(3,4,5a,9a-tetrahydrodibenzofuran-4-yl)-9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole |
|---|---|
| PubChem CID | 134390460 |
| Molecular Formula | C42H45NO |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | 6-(3,4,5a,9a-tetrahydrodibenzofuran-4-yl)-9-(3-cyclohexa-1,5-dien-1-yl-5-cyclohex-2-en-1-ylcyclohexa-1,3-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole |
| SMILES | C1=CC2OC3=C(C=CCC3C3=CC4C5C=CCCC5N(C5=CC(C6=CCCC=C6)=CC(C6C=CCCC6)C5)C4C=C3)C2C=C1 |
| InChI | InChI=1S/C42H45NO/c1-3-12-28(13-4-1)31-24-32(29-14-5-2-6-15-29)26-33(25-31)43-39-20-9-7-16-35(39)38-27-30(22-23-40(38)43)34-18-11-19-37-36-17-8-10-21-41(36)44-42(34)37/h3,5,7-8,10-14,16-17,19,21-25,27,29,32,34-36,38-41H,1-2,4,6,9,15,18,20,26H2 |
| InChIKey | KZBHHAQAYSOBTF-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|