C42H48N2 — CID 170144859
6-[9-(2-cyclohexa-1,3-dien-1-ylcyclohexen-1-yl)-2,3,4,4a,4b,8a-hexahydrocarbazol-3-yl]-9-[(1S)-cyclohex-3-en-1-yl]-2,3,4b,8a-tetrahydrocarbazole (PubChem CID 170144859) has the molecular formula C42H48N2 and a molecular weight of 580.86 g/mol. Its IUPAC name is 6-[9-(2-cyclohexa-1,3-dien-1-ylcyclohexen-1-yl)-2,3,4,4a,4b,8a-hexahydrocarbazol-3-yl]-9-[(1S)-cyclohex-3-en-1-yl]-2,3,4b,8a-tetrahydrocarbazole.
| Compound Name | 6-[9-(2-cyclohexa-1,3-dien-1-ylcyclohexen-1-yl)-2,3,4,4a,4b,8a-hexahydrocarbazol-3-yl]-9-[(1S)-cyclohex-3-en-1-yl]-2,3,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 170144859 |
| Molecular Formula | C42H48N2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 6-[9-(2-cyclohexa-1,3-dien-1-ylcyclohexen-1-yl)-2,3,4,4a,4b,8a-hexahydrocarbazol-3-yl]-9-[(1S)-cyclohex-3-en-1-yl]-2,3,4b,8a-tetrahydrocarbazole |
| SMILES | C1=CCCC(C2=C(N3C4=CCC(C5=CC6C7=CCCC=C7N([C@@H]7CC=CCC7)C6C=C5)CC4C4C=CC=CC43)CCCC2)=C1 |
| InChI | InChI=1S/C42H48N2/c1-3-13-29(14-4-1)33-17-7-10-20-38(33)44-40-22-12-9-19-35(40)37-28-31(24-26-42(37)44)30-23-25-41-36(27-30)34-18-8-11-21-39(34)43(41)32-15-5-2-6-16-32/h1-3,5,9,12-13,18-19,21-23,25-27,31-32,35-37,40-41H,4,6-8,10-11,14-17,20,24,28H2/t31?,32-,35?,36?,37?,40?,41?/m1/s1 |
| InChIKey | TZXNYXCSCLKDEZ-IMKPYPBZSA-N |
| XLogP | 9.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|