C51H52N2 — CID 138625898
9-(9,9-dimethyl-2,3,4,4a,4b,8a-hexahydrofluoren-3-yl)-3-[9-(4-phenylphenyl)-2,3,4,4a,7,8-hexahydrocarbazol-3-yl]-4a,4b,8a,9a-tetrahydrocarbazole (PubChem CID 138625898) has the molecular formula C51H52N2 and a molecular weight of 692.99 g/mol. Its IUPAC name is 9-(9,9-dimethyl-2,3,4,4a,4b,8a-hexahydrofluoren-3-yl)-3-[9-(4-phenylphenyl)-2,3,4,4a,7,8-hexahydrocarbazol-3-yl]-4a,4b,8a,9a-tetrahydrocarbazole.
| Compound Name | 9-(9,9-dimethyl-2,3,4,4a,4b,8a-hexahydrofluoren-3-yl)-3-[9-(4-phenylphenyl)-2,3,4,4a,7,8-hexahydrocarbazol-3-yl]-4a,4b,8a,9a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 138625898 |
| Molecular Formula | C51H52N2 |
| Molecular Weight | 692.99 g/mol |
| Exact Mass | 692.41 |
| IUPAC Name | 9-(9,9-dimethyl-2,3,4,4a,4b,8a-hexahydrofluoren-3-yl)-3-[9-(4-phenylphenyl)-2,3,4,4a,7,8-hexahydrocarbazol-3-yl]-4a,4b,8a,9a-tetrahydrocarbazole |
| SMILES | CC1(C)C2=CCC(N3C4C=CC=CC4C4C=C(C5CC=C6C(C5)C5=C(CCC=C5)N6c5ccc(-c6ccccc6)cc5)C=CC43)CC2C2C=CC=CC21 |
| InChI | InChI=1S/C51H52N2/c1-51(2)45-17-9-6-14-39(45)42-32-38(26-27-46(42)51)53-48-19-11-8-16-41(48)44-31-36(23-29-50(44)53)35-22-28-49-43(30-35)40-15-7-10-18-47(40)52(49)37-24-20-34(21-25-37)33-12-4-3-5-13-33/h3-9,11-17,19-21,23-25,27-29,31,35,38-39,41-45,48,50H,10,18,22,26,30,32H2,1-2H3 |
| InChIKey | FSFFWMKWTHKFLI-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.99 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|