C37H37NS — CID 146360037
6-[(9aR)-1,2,3,5a,9a,9b-hexahydrodibenzothiophen-2-yl]-9-[4-[(1R)-cyclohexa-2,4-dien-1-yl]phenyl]-4b-methyl-8a,9a-dihydro-4aH-carbazole (PubChem CID 146360037) has the molecular formula C37H37NS and a molecular weight of 527.78 g/mol. Its IUPAC name is 6-[(9aR)-1,2,3,5a,9a,9b-hexahydrodibenzothiophen-2-yl]-9-[4-[(1R)-cyclohexa-2,4-dien-1-yl]phenyl]-4b-methyl-8a,9a-dihydro-4aH-carbazole.
| Compound Name | 6-[(9aR)-1,2,3,5a,9a,9b-hexahydrodibenzothiophen-2-yl]-9-[4-[(1R)-cyclohexa-2,4-dien-1-yl]phenyl]-4b-methyl-8a,9a-dihydro-4aH-carbazole |
|---|---|
| PubChem CID | 146360037 |
| Molecular Formula | C37H37NS |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 6-[(9aR)-1,2,3,5a,9a,9b-hexahydrodibenzothiophen-2-yl]-9-[4-[(1R)-cyclohexa-2,4-dien-1-yl]phenyl]-4b-methyl-8a,9a-dihydro-4aH-carbazole |
| SMILES | CC12C=C(C3CC=C4SC5C=CC=C[C@@H]5C4C3)C=CC1N(c1ccc([C@H]3C=CC=CC3)cc1)C1C=CC=CC12 |
| InChI | InChI=1S/C37H37NS/c1-37-24-28(27-17-21-35-31(23-27)30-11-5-8-14-34(30)39-35)18-22-36(37)38(33-13-7-6-12-32(33)37)29-19-15-26(16-20-29)25-9-3-2-4-10-25/h2-9,11-16,18-22,24-25,27,30-34,36H,10,17,23H2,1H3/t25-,27?,30+,31?,32?,33?,34?,36?,37?/m0/s1 |
| InChIKey | VTINKQFTRHIMCP-IOOSUAQYSA-N |
| XLogP | 8.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|