C37H35NS — CID 134390359
3-[(9bS)-9b-methyl-4,4a,5a,9a-tetrahydro-3H-dibenzothiophen-4-yl]-9-(4-phenylphenyl)-4a,4b,8a,9a-tetrahydrocarbazole (PubChem CID 134390359) has the molecular formula C37H35NS and a molecular weight of 525.76 g/mol. Its IUPAC name is 3-[(9bS)-9b-methyl-4,4a,5a,9a-tetrahydro-3H-dibenzothiophen-4-yl]-9-(4-phenylphenyl)-4a,4b,8a,9a-tetrahydrocarbazole.
| Compound Name | 3-[(9bS)-9b-methyl-4,4a,5a,9a-tetrahydro-3H-dibenzothiophen-4-yl]-9-(4-phenylphenyl)-4a,4b,8a,9a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 134390359 |
| Molecular Formula | C37H35NS |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 3-[(9bS)-9b-methyl-4,4a,5a,9a-tetrahydro-3H-dibenzothiophen-4-yl]-9-(4-phenylphenyl)-4a,4b,8a,9a-tetrahydrocarbazole |
| SMILES | C[C@@]12C=CCC(C3=CC4C5C=CC=CC5N(c5ccc(-c6ccccc6)cc5)C4C=C3)C1SC1C=CC=CC12 |
| InChI | InChI=1S/C37H35NS/c1-37-23-9-13-29(36(37)39-35-16-8-6-14-32(35)37)27-19-22-34-31(24-27)30-12-5-7-15-33(30)38(34)28-20-17-26(18-21-28)25-10-3-2-4-11-25/h2-12,14-24,29-36H,13H2,1H3/t29?,30?,31?,32?,33?,34?,35?,36?,37-/m0/s1 |
| InChIKey | PDRONZQXGMGQAY-MFVRHHOMSA-N |
| XLogP | 8.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|