C27H31N — CID 89095763
6-[5-(9,9-dimethyl-4,4a,4b,8a-tetrahydrofluoren-3-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 89095763) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is 6-[5-(9,9-dimethyl-4,4a,4b,8a-tetrahydrofluoren-3-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-[5-(9,9-dimethyl-4,4a,4b,8a-tetrahydrofluoren-3-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89095763 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 6-[5-(9,9-dimethyl-4,4a,4b,8a-tetrahydrofluoren-3-yl)cyclohexa-1,5-dien-1-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | CC1(C)C2=CC=C(C3=CC(C4C=CC=CC4N)=CCC3)CC2C2C=CC=CC21 |
| InChI | InChI=1S/C27H31N/c1-27(2)24-12-5-3-11-22(24)23-17-19(14-15-25(23)27)18-8-7-9-20(16-18)21-10-4-6-13-26(21)28/h3-6,9-16,21-24,26H,7-8,17,28H2,1-2H3 |
| InChIKey | QQRJRMXLYPDGMB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |