C21H29N — CID 66693851
1-[(8R,9S,10R,13S,14S)-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]prop-2-en-1-amine (PubChem CID 66693851) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-[(8R,9S,10R,13S,14S)-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]prop-2-en-1-amine.
| Compound Name | 1-[(8R,9S,10R,13S,14S)-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 66693851 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-[(8R,9S,10R,13S,14S)-13-methyl-7,8,9,10,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]prop-2-en-1-amine |
| SMILES | C=CC(N)C1C[C@]2(C)CCC[C@H]2[C@@H]2CC=C3C=CC=C[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C21H29N/c1-3-19(22)17-13-21(2)12-6-9-18(21)16-11-10-14-7-4-5-8-15(14)20(16)17/h3-5,7-8,10,15-20H,1,6,9,11-13,22H2,2H3/t15-,16-,17?,18-,19?,20+,21-/m0/s1 |
| InChIKey | DUWLLLXEPPVEBZ-GQJNORJYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|