C15H20O4 — CID 134391463
1-[(5R)-5-ethyl-2-hydroxyoxolan-3-yl]ethyl benzoate (PubChem CID 134391463) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(5R)-5-ethyl-2-hydroxyoxolan-3-yl]ethyl benzoate.
| Compound Name | 1-[(5R)-5-ethyl-2-hydroxyoxolan-3-yl]ethyl benzoate |
|---|---|
| PubChem CID | 134391463 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[(5R)-5-ethyl-2-hydroxyoxolan-3-yl]ethyl benzoate |
| SMILES | CC[C@@H]1CC(C(C)OC(=O)c2ccccc2)C(O)O1 |
| InChI | InChI=1S/C15H20O4/c1-3-12-9-13(15(17)19-12)10(2)18-14(16)11-7-5-4-6-8-11/h4-8,10,12-13,15,17H,3,9H2,1-2H3/t10?,12-,13?,15?/m1/s1 |
| InChIKey | NXPCYYDPVMWCDS-LOXWSRGHSA-N |
| XLogP | 2.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |