C17H17BrN2 — CID 134395114
3-bromo-6-methyl-1-(4-methylidenecyclohexyl)indole-5-carbonitrile (PubChem CID 134395114) has the molecular formula C17H17BrN2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 3-bromo-6-methyl-1-(4-methylidenecyclohexyl)indole-5-carbonitrile.
| Compound Name | 3-bromo-6-methyl-1-(4-methylidenecyclohexyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 134395114 |
| Molecular Formula | C17H17BrN2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-bromo-6-methyl-1-(4-methylidenecyclohexyl)indole-5-carbonitrile |
| SMILES | C=C1CCC(n2cc(Br)c3cc(C#N)c(C)cc32)CC1 |
| InChI | InChI=1S/C17H17BrN2/c1-11-3-5-14(6-4-11)20-10-16(18)15-8-13(9-19)12(2)7-17(15)20/h7-8,10,14H,1,3-6H2,2H3 |
| InChIKey | YFQNGVZMRUAUGK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|