C15H15BrN2O — CID 142503080
3-bromo-1-(3-hydroxycyclopentyl)-6-methylindole-5-carbonitrile (PubChem CID 142503080) has the molecular formula C15H15BrN2O and a molecular weight of 319.20 g/mol. Its IUPAC name is 3-bromo-1-(3-hydroxycyclopentyl)-6-methylindole-5-carbonitrile.
| Compound Name | 3-bromo-1-(3-hydroxycyclopentyl)-6-methylindole-5-carbonitrile |
|---|---|
| PubChem CID | 142503080 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-bromo-1-(3-hydroxycyclopentyl)-6-methylindole-5-carbonitrile |
| SMILES | Cc1cc2c(cc1C#N)c(Br)cn2C1CCC(O)C1 |
| InChI | InChI=1S/C15H15BrN2O/c1-9-4-15-13(5-10(9)7-17)14(16)8-18(15)11-2-3-12(19)6-11/h4-5,8,11-12,19H,2-3,6H2,1H3 |
| InChIKey | VFJTUZJORLZFTH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |