C54H37N3OP+ — CID 134395933
8-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-22-hydroxy-22-(3-phenylphenyl)-8-aza-22-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene (PubChem CID 134395933) has the molecular formula C54H37N3OP+ and a molecular weight of 774.88 g/mol. Its IUPAC name is 8-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-22-hydroxy-22-(3-phenylphenyl)-8-aza-22-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene.
| Compound Name | 8-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-22-hydroxy-22-(3-phenylphenyl)-8-aza-22-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene |
|---|---|
| PubChem CID | 134395933 |
| Molecular Formula | C54H37N3OP+ |
| Molecular Weight | 774.88 g/mol |
| Exact Mass | 774.27 |
| IUPAC Name | 8-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-22-hydroxy-22-(3-phenylphenyl)-8-aza-22-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene |
| SMILES | O[P+]1(c2cccc(-c3ccccc3)c2)C2=C(c3ccccc3N(c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C54H37N3OP/c58-59(43-27-17-24-40(35-43)37-18-4-1-5-19-37)51-33-15-12-30-46(51)52-44-28-10-13-31-49(44)57(50-32-14-11-29-45(50)53(52)59)42-26-16-25-41(34-42)54-55-47(38-20-6-2-7-21-38)36-48(56-54)39-22-8-3-9-23-39/h1-36,58H/q+1 |
| InChIKey | KYSBLCYZDUSNKM-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.88 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|