C18H20ClNO4 — CID 13439629
benzyl 5-(acetyloxymethyl)-4-(2-chloroethyl)-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 13439629) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is benzyl 5-(acetyloxymethyl)-4-(2-chloroethyl)-3-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | benzyl 5-(acetyloxymethyl)-4-(2-chloroethyl)-3-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 13439629 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | benzyl 5-(acetyloxymethyl)-4-(2-chloroethyl)-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)OCc1[nH]c(C(=O)OCc2ccccc2)c(C)c1CCCl |
| InChI | InChI=1S/C18H20ClNO4/c1-12-15(8-9-19)16(11-23-13(2)21)20-17(12)18(22)24-10-14-6-4-3-5-7-14/h3-7,20H,8-11H2,1-2H3 |
| InChIKey | KZYRWCSTQADRCN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|