C10H11N3O2S — CID 134397398
ethyl 5-methyl-2-(1,3-thiazol-2-yl)pyrazole-3-carboxylate (PubChem CID 134397398) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is ethyl 5-methyl-2-(1,3-thiazol-2-yl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-(1,3-thiazol-2-yl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134397398 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | ethyl 5-methyl-2-(1,3-thiazol-2-yl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)nn1-c1nccs1 |
| InChI | InChI=1S/C10H11N3O2S/c1-3-15-9(14)8-6-7(2)12-13(8)10-11-4-5-16-10/h4-6H,3H2,1-2H3 |
| InChIKey | HAVLMWLUELUQRQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |