C19H14FN7O — CID 134398026
4-[2-[5-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-1,3,4-oxadiazol-2-yl]-4-pyridinyl]pyridine-2-carbonitrile (PubChem CID 134398026) has the molecular formula C19H14FN7O and a molecular weight of 375.37 g/mol. Its IUPAC name is 4-[2-[5-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-1,3,4-oxadiazol-2-yl]-4-pyridinyl]pyridine-2-carbonitrile.
| Compound Name | 4-[2-[5-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-1,3,4-oxadiazol-2-yl]-4-pyridinyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134398026 |
| Molecular Formula | C19H14FN7O |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-[2-[5-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-1,3,4-oxadiazol-2-yl]-4-pyridinyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(-c2ccnc(-c3nnc([C@@]4(F)CCCN(C#N)C4)o3)c2)ccn1 |
| InChI | InChI=1S/C19H14FN7O/c20-19(4-1-7-27(11-19)12-22)18-26-25-17(28-18)16-9-14(3-6-24-16)13-2-5-23-15(8-13)10-21/h2-3,5-6,8-9H,1,4,7,11H2/t19-/m1/s1 |
| InChIKey | ZGEMGDYXGLAYJB-LJQANCHMSA-N |
| XLogP | 2.81 |
| TPSA | 115.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|