C32H43N5O4S — CID 134398999
N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2,2,4-trimethylpyrrolidin-1-yl]-6-[3-[(2,2,3,3-tetramethylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 134398999) has the molecular formula C32H43N5O4S and a molecular weight of 593.79 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2,2,4-trimethylpyrrolidin-1-yl]-6-[3-[(2,2,3,3-tetramethylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2,2,4-trimethylpyrrolidin-1-yl]-6-[3-[(2,2,3,3-tetramethylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134398999 |
| Molecular Formula | C32H43N5O4S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2,2,4-trimethylpyrrolidin-1-yl]-6-[3-[(2,2,3,3-tetramethylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC[C@]1(C)CN(c2nc(-n3ccc(OCC4C(C)(C)C4(C)C)n3)ccc2C(=O)NS(=O)(=O)c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C32H43N5O4S/c1-9-32(8)20-29(2,3)36(21-32)27-23(28(38)35-42(39,40)22-13-11-10-12-14-22)15-16-25(33-27)37-18-17-26(34-37)41-19-24-30(4,5)31(24,6)7/h10-18,24H,9,19-21H2,1-8H3,(H,35,38)/t32-/m0/s1 |
| InChIKey | YDGNVZVWKAJZBW-YTTGMZPUSA-N |
| XLogP | 5.85 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |