C21H29NO5S — CID 134400949
4-[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylsulfanylmethyl]benzoic acid (PubChem CID 134400949) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is 4-[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylsulfanylmethyl]benzoic acid.
| Compound Name | 4-[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylsulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 134400949 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylsulfanylmethyl]benzoic acid |
| SMILES | CC1CC1(CC(C)(C)C)C(=O)OCCNC(=O)SCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H29NO5S/c1-14-11-21(14,13-20(2,3)4)18(25)27-10-9-22-19(26)28-12-15-5-7-16(8-6-15)17(23)24/h5-8,14H,9-13H2,1-4H3,(H,22,26)(H,23,24) |
| InChIKey | TVZPBJRSDAZYCI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|