C21H30N2O5 — CID 134401025
4-[[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylamino]methyl]benzoic acid (PubChem CID 134401025) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134401025 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-[[2-[1-(2,2-dimethylpropyl)-2-methylcyclopropanecarbonyl]oxyethylcarbamoylamino]methyl]benzoic acid |
| SMILES | CC1CC1(CC(C)(C)C)C(=O)OCCNC(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H30N2O5/c1-14-11-21(14,13-20(2,3)4)18(26)28-10-9-22-19(27)23-12-15-5-7-16(8-6-15)17(24)25/h5-8,14H,9-13H2,1-4H3,(H,24,25)(H2,22,23,27) |
| InChIKey | LENGJUHTLVEMGE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|