C21H27FN4O3S — CID 134401437
7-[(3R)-3-(2-aminopropan-2-yl)pyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-8-methoxy-3a,9a-dihydro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 134401437) has the molecular formula C21H27FN4O3S and a molecular weight of 434.54 g/mol. Its IUPAC name is 7-[(3R)-3-(2-aminopropan-2-yl)pyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-8-methoxy-3a,9a-dihydro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 7-[(3R)-3-(2-aminopropan-2-yl)pyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-8-methoxy-3a,9a-dihydro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 134401437 |
| Molecular Formula | C21H27FN4O3S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 7-[(3R)-3-(2-aminopropan-2-yl)pyrrolidin-1-yl]-9-cyclopropyl-6-fluoro-8-methoxy-3a,9a-dihydro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | COc1c(N2CC[C@@H](C(C)(C)N)C2)c(F)cc2c1N(C1CC1)C1SNC(=O)C1C2=O |
| InChI | InChI=1S/C21H27FN4O3S/c1-21(2,23)10-6-7-25(9-10)16-13(22)8-12-15(18(16)29-3)26(11-4-5-11)20-14(17(12)27)19(28)24-30-20/h8,10-11,14,20H,4-7,9,23H2,1-3H3,(H,24,28)/t10-,14?,20?/m1/s1 |
| InChIKey | XAIIVKSEVYTZNB-PJBCTWBCSA-N |
| XLogP | 2.28 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|