C22H28ClN3O2 — CID 134405112
5-chloro-2-methoxy-4-[4-[4-(3-methylpyrrolidin-1-yl)phenoxy]piperidin-1-yl]pyridine (PubChem CID 134405112) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-[4-[4-(3-methylpyrrolidin-1-yl)phenoxy]piperidin-1-yl]pyridine.
| Compound Name | 5-chloro-2-methoxy-4-[4-[4-(3-methylpyrrolidin-1-yl)phenoxy]piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 134405112 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-chloro-2-methoxy-4-[4-[4-(3-methylpyrrolidin-1-yl)phenoxy]piperidin-1-yl]pyridine |
| SMILES | COc1cc(N2CCC(Oc3ccc(N4CCC(C)C4)cc3)CC2)c(Cl)cn1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-16-7-10-26(15-16)17-3-5-18(6-4-17)28-19-8-11-25(12-9-19)21-13-22(27-2)24-14-20(21)23/h3-6,13-14,16,19H,7-12,15H2,1-2H3 |
| InChIKey | NZSFGXUAFPQBLS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|